C26H26N2O — CID 166627944
5-[4-(4-tert-butylphenyl)phenyl]-3-(4-methoxyphenyl)-1H-pyrazole (PubChem CID 166627944) has the molecular formula C26H26N2O and a molecular weight of 382.51 g/mol. Its IUPAC name is 5-[4-(4-tert-butylphenyl)phenyl]-3-(4-methoxyphenyl)-1H-pyrazole.
| Compound Name | 5-[4-(4-tert-butylphenyl)phenyl]-3-(4-methoxyphenyl)-1H-pyrazole |
|---|---|
| PubChem CID | 166627944 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 5-[4-(4-tert-butylphenyl)phenyl]-3-(4-methoxyphenyl)-1H-pyrazole |
| SMILES | COc1ccc(-c2cc(-c3ccc(-c4ccc(C(C)(C)C)cc4)cc3)[nH]n2)cc1 |
| InChI | InChI=1S/C26H26N2O/c1-26(2,3)22-13-9-19(10-14-22)18-5-7-20(8-6-18)24-17-25(28-27-24)21-11-15-23(29-4)16-12-21/h5-17H,1-4H3,(H,27,28) |
| InChIKey | HKDBXIBAXQZUSN-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |