C13H9F7N2O — CID 2782546
5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(4-methoxyphenyl)-1H-pyrazole (PubChem CID 2782546) has the molecular formula C13H9F7N2O and a molecular weight of 342.21 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(4-methoxyphenyl)-1H-pyrazole.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(4-methoxyphenyl)-1H-pyrazole |
|---|---|
| PubChem CID | 2782546 |
| Molecular Formula | C13H9F7N2O |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(4-methoxyphenyl)-1H-pyrazole |
| SMILES | COc1ccc(-c2cc(C(F)(F)C(F)(F)C(F)(F)F)[nH]n2)cc1 |
| InChI | InChI=1S/C13H9F7N2O/c1-23-8-4-2-7(3-5-8)9-6-10(22-21-9)11(14,15)12(16,17)13(18,19)20/h2-6H,1H3,(H,21,22) |
| InChIKey | FTUWBRLQSHATEJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|