C44H34O6 — CID 163210794
1,3,6,8-tetrakis(4-methoxyphenyl)pyrene-2,7-diol (PubChem CID 163210794) has the molecular formula C44H34O6 and a molecular weight of 658.75 g/mol. Its IUPAC name is 1,3,6,8-tetrakis(4-methoxyphenyl)pyrene-2,7-diol.
| Compound Name | 1,3,6,8-tetrakis(4-methoxyphenyl)pyrene-2,7-diol |
|---|---|
| PubChem CID | 163210794 |
| Molecular Formula | C44H34O6 |
| Molecular Weight | 658.75 g/mol |
| Exact Mass | 658.24 |
| IUPAC Name | 1,3,6,8-tetrakis(4-methoxyphenyl)pyrene-2,7-diol |
| SMILES | COc1ccc(-c2c(O)c(-c3ccc(OC)cc3)c3ccc4c(-c5ccc(OC)cc5)c(O)c(-c5ccc(OC)cc5)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C44H34O6/c1-47-29-13-5-25(6-14-29)37-33-21-22-35-39(27-9-17-31(49-3)18-10-27)44(46)40(28-11-19-32(50-4)20-12-28)36-24-23-34(41(33)42(35)36)38(43(37)45)26-7-15-30(48-2)16-8-26/h5-24,45-46H,1-4H3 |
| InChIKey | INGILXCCWSKOGV-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.75 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|