C46H38O5 — CID 175215990
2-ethoxy-1,3,4,5-tetrakis(4-methoxyphenyl)pyrene (PubChem CID 175215990) has the molecular formula C46H38O5 and a molecular weight of 670.80 g/mol. Its IUPAC name is 2-ethoxy-1,3,4,5-tetrakis(4-methoxyphenyl)pyrene.
| Compound Name | 2-ethoxy-1,3,4,5-tetrakis(4-methoxyphenyl)pyrene |
|---|---|
| PubChem CID | 175215990 |
| Molecular Formula | C46H38O5 |
| Molecular Weight | 670.80 g/mol |
| Exact Mass | 670.27 |
| IUPAC Name | 2-ethoxy-1,3,4,5-tetrakis(4-methoxyphenyl)pyrene |
| SMILES | CCOc1c(-c2ccc(OC)cc2)c2ccc3cccc4c(-c5ccc(OC)cc5)c(-c5ccc(OC)cc5)c(c1-c1ccc(OC)cc1)c2c34 |
| InChI | InChI=1S/C46H38O5/c1-6-51-46-41(30-12-21-34(48-3)22-13-30)38-27-18-28-8-7-9-37-39(29-10-19-33(47-2)20-11-29)42(31-14-23-35(49-4)24-15-31)45(44(38)40(28)37)43(46)32-16-25-36(50-5)26-17-32/h7-27H,6H2,1-5H3 |
| InChIKey | NWJMBFKLKYUKMZ-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.80 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|