C31H28O2 — CID 134959930
9,10-bis(4-methoxyphenyl)-1-propan-2-ylphenanthrene (PubChem CID 134959930) has the molecular formula C31H28O2 and a molecular weight of 432.56 g/mol. Its IUPAC name is 9,10-bis(4-methoxyphenyl)-1-propan-2-ylphenanthrene.
| Compound Name | 9,10-bis(4-methoxyphenyl)-1-propan-2-ylphenanthrene |
|---|---|
| PubChem CID | 134959930 |
| Molecular Formula | C31H28O2 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 9,10-bis(4-methoxyphenyl)-1-propan-2-ylphenanthrene |
| SMILES | COc1ccc(-c2c(-c3ccc(OC)cc3)c3c(C(C)C)cccc3c3ccccc23)cc1 |
| InChI | InChI=1S/C31H28O2/c1-20(2)25-10-7-11-28-26-8-5-6-9-27(26)29(21-12-16-23(32-3)17-13-21)30(31(25)28)22-14-18-24(33-4)19-15-22/h5-20H,1-4H3 |
| InChIKey | XSOSRVXTUNYEAY-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|