C36H42N4O10S — CID 87876029
bis(2,5-diethoxy-4-(4-ethoxyphenyl)benzenediazonium);sulfate (PubChem CID 87876029) has the molecular formula C36H42N4O10S and a molecular weight of 722.82 g/mol. Its IUPAC name is bis(2,5-diethoxy-4-(4-ethoxyphenyl)benzenediazonium);sulfate.
| Compound Name | bis(2,5-diethoxy-4-(4-ethoxyphenyl)benzenediazonium);sulfate |
|---|---|
| PubChem CID | 87876029 |
| Molecular Formula | C36H42N4O10S |
| Molecular Weight | 722.82 g/mol |
| Exact Mass | 722.26 |
| IUPAC Name | bis(2,5-diethoxy-4-(4-ethoxyphenyl)benzenediazonium);sulfate |
| SMILES | CCOc1ccc(-c2cc(OCC)c([N+]#N)cc2OCC)cc1.CCOc1ccc(-c2cc(OCC)c([N+]#N)cc2OCC)cc1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C18H21N2O3.H2O4S/c2*1-4-21-14-9-7-13(8-10-14)15-11-18(23-6-3)16(20-19)12-17(15)22-5-2;1-5(2,3)4/h2*7-12H,4-6H2,1-3H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | PWOPURBDIWIDHF-UHFFFAOYSA-L |
| XLogP | 8.73 |
| TPSA | 191.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.82 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|