About 4-ethoxybenzenediazonium nitrate
4-ethoxybenzenediazonium nitrate (PubChem CID 19702448) has the molecular formula C8H9N3O4
and a molecular weight of 211.18 g/mol. Its IUPAC name is 4-ethoxybenzenediazonium nitrate.
Molecular Properties
| Compound Name | 4-ethoxybenzenediazonium nitrate |
| PubChem CID | 19702448 |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 4-ethoxybenzenediazonium nitrate |
| SMILES | CCOc1ccc([N+]#N)cc1.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C8H9N2O.NO3/c1-2-11-8-5-3-7(10-9)4-6-8;2-1(3)4/h3-6H,2H2,1H3;/q+1;-1 |
| InChIKey | YVIYVOQUNFDSPE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxybenzenediazonium nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxybenzenediazonium nitrate?
The IUPAC name of 4-ethoxybenzenediazonium nitrate (CID 19702448) is 4-ethoxybenzenediazonium nitrate.
What is the SMILES notation for 4-ethoxybenzenediazonium nitrate?
The canonical SMILES for 4-ethoxybenzenediazonium nitrate is CCOc1ccc([N+]#N)cc1.O=[N+]([O-])[O-].
What is the InChIKey of 4-ethoxybenzenediazonium nitrate?
The InChIKey is YVIYVOQUNFDSPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N2O.NO3/c1-2-11-8-5-3-7(10-9)4-6-8;2-1(3)4/h3-6H,2H2,1H3;/q+1;-1.
What are the key properties of 4-ethoxybenzenediazonium nitrate?
4-ethoxybenzenediazonium nitrate has a molecular weight of 211.18 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxybenzenediazonium nitrate is sourced from PubChem (CID 19702448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).