C16H18N2O7S — CID 86032613
2,5-diethoxy-4-phenoxybenzenediazonium;hydrogen sulfate (PubChem CID 86032613) has the molecular formula C16H18N2O7S and a molecular weight of 382.39 g/mol. Its IUPAC name is 2,5-diethoxy-4-phenoxybenzenediazonium;hydrogen sulfate.
| Compound Name | 2,5-diethoxy-4-phenoxybenzenediazonium;hydrogen sulfate |
|---|---|
| PubChem CID | 86032613 |
| Molecular Formula | C16H18N2O7S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2,5-diethoxy-4-phenoxybenzenediazonium;hydrogen sulfate |
| SMILES | CCOc1cc(Oc2ccccc2)c(OCC)cc1[N+]#N.O=S(=O)([O-])O |
| InChI | InChI=1S/C16H17N2O3.H2O4S/c1-3-19-14-11-16(21-12-8-6-5-7-9-12)15(20-4-2)10-13(14)18-17;1-5(2,3)4/h5-11H,3-4H2,1-2H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | BSXJKRUGGVXZAE-UHFFFAOYSA-M |
| XLogP | 3.77 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|