C27H30N4O4+2 — CID 3343157
4-[(4-diazonio-2,5-diethoxyphenyl)-phenylmethyl]-2,5-diethoxybenzenediazonium (PubChem CID 3343157) has the molecular formula C27H30N4O4+2 and a molecular weight of 474.56 g/mol. Its IUPAC name is 4-[(4-diazonio-2,5-diethoxyphenyl)-phenylmethyl]-2,5-diethoxybenzenediazonium.
| Compound Name | 4-[(4-diazonio-2,5-diethoxyphenyl)-phenylmethyl]-2,5-diethoxybenzenediazonium |
|---|---|
| PubChem CID | 3343157 |
| Molecular Formula | C27H30N4O4+2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 4-[(4-diazonio-2,5-diethoxyphenyl)-phenylmethyl]-2,5-diethoxybenzenediazonium |
| SMILES | CCOc1cc(C(c2ccccc2)c2cc(OCC)c([N+]#N)cc2OCC)c(OCC)cc1[N+]#N |
| InChI | InChI=1S/C27H30N4O4/c1-5-32-23-16-21(30-28)25(34-7-3)14-19(23)27(18-12-10-9-11-13-18)20-15-26(35-8-4)22(31-29)17-24(20)33-6-2/h9-17,27H,5-8H2,1-4H3/q+2 |
| InChIKey | IJXNMSNSJRHDQL-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|