C17H20ClN3O2 — CID 21441178
4-(benzylamino)-2,5-diethoxybenzenediazonium chloride (PubChem CID 21441178) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 4-(benzylamino)-2,5-diethoxybenzenediazonium chloride.
| Compound Name | 4-(benzylamino)-2,5-diethoxybenzenediazonium chloride |
|---|---|
| PubChem CID | 21441178 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 4-(benzylamino)-2,5-diethoxybenzenediazonium chloride |
| SMILES | CCOc1cc(NCc2ccccc2)c(OCC)cc1[N+]#N.[Cl-] |
| InChI | InChI=1S/C17H20N3O2.ClH/c1-3-21-16-11-15(20-18)17(22-4-2)10-14(16)19-12-13-8-6-5-7-9-13;/h5-11,19H,3-4,12H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | OIYXNDDZFHLAIE-UHFFFAOYSA-M |
| XLogP | 1.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|