C13H10BCl2F4N3 — CID 21402812
4-(benzylamino)-2,5-dichlorobenzenediazonium tetrafluoroborate (PubChem CID 21402812) has the molecular formula C13H10BCl2F4N3 and a molecular weight of 365.95 g/mol. Its IUPAC name is 4-(benzylamino)-2,5-dichlorobenzenediazonium tetrafluoroborate.
| Compound Name | 4-(benzylamino)-2,5-dichlorobenzenediazonium tetrafluoroborate |
|---|---|
| PubChem CID | 21402812 |
| Molecular Formula | C13H10BCl2F4N3 |
| Molecular Weight | 365.95 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 4-(benzylamino)-2,5-dichlorobenzenediazonium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.N#[N+]c1cc(Cl)c(NCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C13H10Cl2N3.BF4/c14-10-7-13(18-16)11(15)6-12(10)17-8-9-4-2-1-3-5-9;2-1(3,4)5/h1-7,17H,8H2;/q+1;-1 |
| InChIKey | NYKRYXKHFFEEJJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.95 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|