C24H22N3O4+ — CID 21118135
4-(dibenzoylamino)-2,5-diethoxybenzenediazonium (PubChem CID 21118135) has the molecular formula C24H22N3O4+ and a molecular weight of 416.46 g/mol. Its IUPAC name is 4-(dibenzoylamino)-2,5-diethoxybenzenediazonium.
| Compound Name | 4-(dibenzoylamino)-2,5-diethoxybenzenediazonium |
|---|---|
| PubChem CID | 21118135 |
| Molecular Formula | C24H22N3O4+ |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-(dibenzoylamino)-2,5-diethoxybenzenediazonium |
| SMILES | CCOc1cc(N(C(=O)c2ccccc2)C(=O)c2ccccc2)c(OCC)cc1[N+]#N |
| InChI | InChI=1S/C24H22N3O4/c1-3-30-21-16-20(22(31-4-2)15-19(21)26-25)27(23(28)17-11-7-5-8-12-17)24(29)18-13-9-6-10-14-18/h5-16H,3-4H2,1-2H3/q+1 |
| InChIKey | BARMRYGUFVMSEB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|