C17H22ClNO2 — CID 121438268
[(2,4-diethoxyphenyl)-phenylmethyl]azanium chloride (PubChem CID 121438268) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is [(2,4-diethoxyphenyl)-phenylmethyl]azanium chloride.
| Compound Name | [(2,4-diethoxyphenyl)-phenylmethyl]azanium chloride |
|---|---|
| PubChem CID | 121438268 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | [(2,4-diethoxyphenyl)-phenylmethyl]azanium chloride |
| SMILES | CCOc1ccc(C([NH3+])c2ccccc2)c(OCC)c1.[Cl-] |
| InChI | InChI=1S/C17H21NO2.ClH/c1-3-19-14-10-11-15(16(12-14)20-4-2)17(18)13-8-6-5-7-9-13;/h5-12,17H,3-4,18H2,1-2H3;1H |
| InChIKey | HFRBWLVJHIUXFN-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |