C18H24ClNO3 — CID 23004770
[(3,4-diethoxyphenyl)-(4-methoxyphenyl)methyl]azanium chloride (PubChem CID 23004770) has the molecular formula C18H24ClNO3 and a molecular weight of 337.85 g/mol. Its IUPAC name is [(3,4-diethoxyphenyl)-(4-methoxyphenyl)methyl]azanium chloride.
| Compound Name | [(3,4-diethoxyphenyl)-(4-methoxyphenyl)methyl]azanium chloride |
|---|---|
| PubChem CID | 23004770 |
| Molecular Formula | C18H24ClNO3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | [(3,4-diethoxyphenyl)-(4-methoxyphenyl)methyl]azanium chloride |
| SMILES | CCOc1ccc(C([NH3+])c2ccc(OC)cc2)cc1OCC.[Cl-] |
| InChI | InChI=1S/C18H23NO3.ClH/c1-4-21-16-11-8-14(12-17(16)22-5-2)18(19)13-6-9-15(20-3)10-7-13;/h6-12,18H,4-5,19H2,1-3H3;1H |
| InChIKey | DJAHDPVUPXFJRD-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 55.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |