C18H24NO3+ — CID 4712225
[(3,4-diethoxyphenyl)-(4-methoxyphenyl)methyl]azanium (PubChem CID 4712225) has the molecular formula C18H24NO3+ and a molecular weight of 302.39 g/mol. Its IUPAC name is [(3,4-diethoxyphenyl)-(4-methoxyphenyl)methyl]azanium.
| Compound Name | [(3,4-diethoxyphenyl)-(4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 4712225 |
| Molecular Formula | C18H24NO3+ |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | [(3,4-diethoxyphenyl)-(4-methoxyphenyl)methyl]azanium |
| SMILES | CCOc1ccc(C([NH3+])c2ccc(OC)cc2)cc1OCC |
| InChI | InChI=1S/C18H23NO3/c1-4-21-16-11-8-14(12-17(16)22-5-2)18(19)13-6-9-15(20-3)10-7-13/h6-12,18H,4-5,19H2,1-3H3/p+1 |
| InChIKey | MGSHIGRWZHSRMW-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 55.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |