C17H22ClNO3 — CID 23004771
[(3,4-dimethoxyphenyl)-(4-ethoxyphenyl)methyl]azanium chloride (PubChem CID 23004771) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is [(3,4-dimethoxyphenyl)-(4-ethoxyphenyl)methyl]azanium chloride.
| Compound Name | [(3,4-dimethoxyphenyl)-(4-ethoxyphenyl)methyl]azanium chloride |
|---|---|
| PubChem CID | 23004771 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | [(3,4-dimethoxyphenyl)-(4-ethoxyphenyl)methyl]azanium chloride |
| SMILES | CCOc1ccc(C([NH3+])c2ccc(OC)c(OC)c2)cc1.[Cl-] |
| InChI | InChI=1S/C17H21NO3.ClH/c1-4-21-14-8-5-12(6-9-14)17(18)13-7-10-15(19-2)16(11-13)20-3;/h5-11,17H,4,18H2,1-3H3;1H |
| InChIKey | VMECNUWGGSOUCE-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 55.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |