C16H20NO2+ — CID 7183177
[(S)-(3,4-dimethoxyphenyl)-(4-methylphenyl)methyl]azanium (PubChem CID 7183177) has the molecular formula C16H20NO2+ and a molecular weight of 258.34 g/mol. Its IUPAC name is [(S)-(3,4-dimethoxyphenyl)-(4-methylphenyl)methyl]azanium.
| Compound Name | [(S)-(3,4-dimethoxyphenyl)-(4-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7183177 |
| Molecular Formula | C16H20NO2+ |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | [(S)-(3,4-dimethoxyphenyl)-(4-methylphenyl)methyl]azanium |
| SMILES | COc1ccc([C@@H]([NH3+])c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C16H19NO2/c1-11-4-6-12(7-5-11)16(17)13-8-9-14(18-2)15(10-13)19-3/h4-10,16H,17H2,1-3H3/p+1/t16-/m0/s1 |
| InChIKey | BNXPRGZUEODGLP-INIZCTEOSA-O |
| XLogP | 2.34 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |