C9H13NO5P- — CID 2363891
[(R)-(3,4-dimethoxyphenyl)-phosphonatomethyl]azanium (PubChem CID 2363891) has the molecular formula C9H13NO5P- and a molecular weight of 246.18 g/mol. Its IUPAC name is [(R)-(3,4-dimethoxyphenyl)-phosphonatomethyl]azanium.
| Compound Name | [(R)-(3,4-dimethoxyphenyl)-phosphonatomethyl]azanium |
|---|---|
| PubChem CID | 2363891 |
| Molecular Formula | C9H13NO5P- |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | [(R)-(3,4-dimethoxyphenyl)-phosphonatomethyl]azanium |
| SMILES | COc1ccc([C@H]([NH3+])P(=O)([O-])[O-])cc1OC |
| InChI | InChI=1S/C9H14NO5P/c1-14-7-4-3-6(5-8(7)15-2)9(10)16(11,12)13/h3-5,9H,10H2,1-2H3,(H2,11,12,13)/p-1/t9-/m1/s1 |
| InChIKey | AMMIPTZQPRJUAU-SECBINFHSA-M |
| XLogP | -1.14 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|