C17H22N2O2 — CID 65378384
1-(3,4-dimethoxyphenyl)-N-(4-methylphenyl)ethane-1,2-diamine (PubChem CID 65378384) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-(4-methylphenyl)ethane-1,2-diamine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-(4-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65378384 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-(4-methylphenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(C(CN)Nc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C17H22N2O2/c1-12-4-7-14(8-5-12)19-15(11-18)13-6-9-16(20-2)17(10-13)21-3/h4-10,15,19H,11,18H2,1-3H3 |
| InChIKey | UJVVILOFYXHJJC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |