C18H25N3O3 — CID 170894838
2-[4-(1,2-diaminoethyl)-2-methoxyphenoxy]-1-(4-methylanilino)ethanol (PubChem CID 170894838) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-[4-(1,2-diaminoethyl)-2-methoxyphenoxy]-1-(4-methylanilino)ethanol.
| Compound Name | 2-[4-(1,2-diaminoethyl)-2-methoxyphenoxy]-1-(4-methylanilino)ethanol |
|---|---|
| PubChem CID | 170894838 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-[4-(1,2-diaminoethyl)-2-methoxyphenoxy]-1-(4-methylanilino)ethanol |
| SMILES | COc1cc(C(N)CN)ccc1OCC(O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C18H25N3O3/c1-12-3-6-14(7-4-12)21-18(22)11-24-16-8-5-13(15(20)10-19)9-17(16)23-2/h3-9,15,18,21-22H,10-11,19-20H2,1-2H3 |
| InChIKey | ULZVEGFUNHIBDH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|