C9H13IN2O — CID 130741212
(1S)-1-(4-iodo-3-methoxyphenyl)ethane-1,2-diamine (PubChem CID 130741212) has the molecular formula C9H13IN2O and a molecular weight of 292.12 g/mol. Its IUPAC name is (1S)-1-(4-iodo-3-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(4-iodo-3-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 130741212 |
| Molecular Formula | C9H13IN2O |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | (1S)-1-(4-iodo-3-methoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1cc([C@H](N)CN)ccc1I |
| InChI | InChI=1S/C9H13IN2O/c1-13-9-4-6(8(12)5-11)2-3-7(9)10/h2-4,8H,5,11-12H2,1H3/t8-/m1/s1 |
| InChIKey | CXUUKGFCKNXHBJ-MRVPVSSYSA-N |
| XLogP | 1.26 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|