C16H19BrN2O2 — CID 65377060
N-(4-bromophenyl)-1-(3,4-dimethoxyphenyl)ethane-1,2-diamine (PubChem CID 65377060) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-(3,4-dimethoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-(4-bromophenyl)-1-(3,4-dimethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65377060 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | N-(4-bromophenyl)-1-(3,4-dimethoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(C(CN)Nc2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C16H19BrN2O2/c1-20-15-8-3-11(9-16(15)21-2)14(10-18)19-13-6-4-12(17)5-7-13/h3-9,14,19H,10,18H2,1-2H3 |
| InChIKey | WJUVXGCGFZIRTM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |