C20H26O6 — CID 134831013
1-(4-ethoxy-3,5-dimethoxyphenyl)-2-(4-ethoxyphenyl)ethane-1,2-diol (PubChem CID 134831013) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is 1-(4-ethoxy-3,5-dimethoxyphenyl)-2-(4-ethoxyphenyl)ethane-1,2-diol.
| Compound Name | 1-(4-ethoxy-3,5-dimethoxyphenyl)-2-(4-ethoxyphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 134831013 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-(4-ethoxy-3,5-dimethoxyphenyl)-2-(4-ethoxyphenyl)ethane-1,2-diol |
| SMILES | CCOc1ccc(C(O)C(O)c2cc(OC)c(OCC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H26O6/c1-5-25-15-9-7-13(8-10-15)18(21)19(22)14-11-16(23-3)20(26-6-2)17(12-14)24-4/h7-12,18-19,21-22H,5-6H2,1-4H3 |
| InChIKey | UIMFQZUIXMSGSM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |