C43H58O8P2 — CID 19858272
3-bis(2,4-diethoxyphenyl)phosphanylpropyl-bis(2,4-diethoxyphenyl)phosphane (PubChem CID 19858272) has the molecular formula C43H58O8P2 and a molecular weight of 764.88 g/mol. Its IUPAC name is 3-bis(2,4-diethoxyphenyl)phosphanylpropyl-bis(2,4-diethoxyphenyl)phosphane.
| Compound Name | 3-bis(2,4-diethoxyphenyl)phosphanylpropyl-bis(2,4-diethoxyphenyl)phosphane |
|---|---|
| PubChem CID | 19858272 |
| Molecular Formula | C43H58O8P2 |
| Molecular Weight | 764.88 g/mol |
| Exact Mass | 764.36 |
| IUPAC Name | 3-bis(2,4-diethoxyphenyl)phosphanylpropyl-bis(2,4-diethoxyphenyl)phosphane |
| SMILES | CCOc1ccc(P(CCCP(c2ccc(OCC)cc2OCC)c2ccc(OCC)cc2OCC)c2ccc(OCC)cc2OCC)c(OCC)c1 |
| InChI | InChI=1S/C43H58O8P2/c1-9-44-32-18-22-40(36(28-32)48-13-5)52(41-23-19-33(45-10-2)29-37(41)49-14-6)26-17-27-53(42-24-20-34(46-11-3)30-38(42)50-15-7)43-25-21-35(47-12-4)31-39(43)51-16-8/h18-25,28-31H,9-17,26-27H2,1-8H3 |
| InChIKey | RXPIIPVVYYNKFG-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.88 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|