C18H18F3O3P — CID 154304054
[(2,4-diethoxyphenyl)-(trifluoromethyl)phosphanyl]-phenylmethanone (PubChem CID 154304054) has the molecular formula C18H18F3O3P and a molecular weight of 370.31 g/mol. Its IUPAC name is [(2,4-diethoxyphenyl)-(trifluoromethyl)phosphanyl]-phenylmethanone.
| Compound Name | [(2,4-diethoxyphenyl)-(trifluoromethyl)phosphanyl]-phenylmethanone |
|---|---|
| PubChem CID | 154304054 |
| Molecular Formula | C18H18F3O3P |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | [(2,4-diethoxyphenyl)-(trifluoromethyl)phosphanyl]-phenylmethanone |
| SMILES | CCOc1ccc(P(C(=O)c2ccccc2)C(F)(F)F)c(OCC)c1 |
| InChI | InChI=1S/C18H18F3O3P/c1-3-23-14-10-11-16(15(12-14)24-4-2)25(18(19,20)21)17(22)13-8-6-5-7-9-13/h5-12H,3-4H2,1-2H3 |
| InChIKey | YGRILRJDYWECSQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|