C23H31O5P — CID 70013713
[(2,4-diethoxyphenyl)-(2-ethoxyethoxy)phosphanyl]-(2,6-dimethylphenyl)methanone (PubChem CID 70013713) has the molecular formula C23H31O5P and a molecular weight of 418.47 g/mol. Its IUPAC name is [(2,4-diethoxyphenyl)-(2-ethoxyethoxy)phosphanyl]-(2,6-dimethylphenyl)methanone.
| Compound Name | [(2,4-diethoxyphenyl)-(2-ethoxyethoxy)phosphanyl]-(2,6-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 70013713 |
| Molecular Formula | C23H31O5P |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [(2,4-diethoxyphenyl)-(2-ethoxyethoxy)phosphanyl]-(2,6-dimethylphenyl)methanone |
| SMILES | CCOCCOP(C(=O)c1c(C)cccc1C)c1ccc(OCC)cc1OCC |
| InChI | InChI=1S/C23H31O5P/c1-6-25-14-15-28-29(23(24)22-17(4)10-9-11-18(22)5)21-13-12-19(26-7-2)16-20(21)27-8-3/h9-13,16H,6-8,14-15H2,1-5H3 |
| InChIKey | SVDCBRRBOOHLOF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|