C19H22ClO5P — CID 70015557
(2-chloro-6-methylphenyl)-[(2,4-dimethoxyphenyl)-(2-methoxyethoxy)phosphanyl]methanone (PubChem CID 70015557) has the molecular formula C19H22ClO5P and a molecular weight of 396.81 g/mol. Its IUPAC name is (2-chloro-6-methylphenyl)-[(2,4-dimethoxyphenyl)-(2-methoxyethoxy)phosphanyl]methanone.
| Compound Name | (2-chloro-6-methylphenyl)-[(2,4-dimethoxyphenyl)-(2-methoxyethoxy)phosphanyl]methanone |
|---|---|
| PubChem CID | 70015557 |
| Molecular Formula | C19H22ClO5P |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (2-chloro-6-methylphenyl)-[(2,4-dimethoxyphenyl)-(2-methoxyethoxy)phosphanyl]methanone |
| SMILES | COCCOP(C(=O)c1c(C)cccc1Cl)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C19H22ClO5P/c1-13-6-5-7-15(20)18(13)19(21)26(25-11-10-22-2)17-9-8-14(23-3)12-16(17)24-4/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | PUCCFFWCUXABKE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|