C20H23O2P — CID 134261084
[(2,6-dimethylbenzoyl)-ethylphosphanyl]-(2,6-dimethylphenyl)methanone (PubChem CID 134261084) has the molecular formula C20H23O2P and a molecular weight of 326.38 g/mol. Its IUPAC name is [(2,6-dimethylbenzoyl)-ethylphosphanyl]-(2,6-dimethylphenyl)methanone.
| Compound Name | [(2,6-dimethylbenzoyl)-ethylphosphanyl]-(2,6-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 134261084 |
| Molecular Formula | C20H23O2P |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [(2,6-dimethylbenzoyl)-ethylphosphanyl]-(2,6-dimethylphenyl)methanone |
| SMILES | CCP(C(=O)c1c(C)cccc1C)C(=O)c1c(C)cccc1C |
| InChI | InChI=1S/C20H23O2P/c1-6-23(19(21)17-13(2)9-7-10-14(17)3)20(22)18-15(4)11-8-12-16(18)5/h7-12H,6H2,1-5H3 |
| InChIKey | JZINRJMDYKTWQD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|