C34H43O2P — CID 174970752
[(2,6-dimethylbenzoyl)-(2,4-dipentylphenyl)phosphanyl]-(2,6-dimethylphenyl)methanone (PubChem CID 174970752) has the molecular formula C34H43O2P and a molecular weight of 514.69 g/mol. Its IUPAC name is [(2,6-dimethylbenzoyl)-(2,4-dipentylphenyl)phosphanyl]-(2,6-dimethylphenyl)methanone.
| Compound Name | [(2,6-dimethylbenzoyl)-(2,4-dipentylphenyl)phosphanyl]-(2,6-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 174970752 |
| Molecular Formula | C34H43O2P |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | [(2,6-dimethylbenzoyl)-(2,4-dipentylphenyl)phosphanyl]-(2,6-dimethylphenyl)methanone |
| SMILES | CCCCCc1ccc(P(C(=O)c2c(C)cccc2C)C(=O)c2c(C)cccc2C)c(CCCCC)c1 |
| InChI | InChI=1S/C34H43O2P/c1-7-9-11-19-28-21-22-30(29(23-28)20-12-10-8-2)37(33(35)31-24(3)15-13-16-25(31)4)34(36)32-26(5)17-14-18-27(32)6/h13-18,21-23H,7-12,19-20H2,1-6H3 |
| InChIKey | VVWXWMURTPKZSB-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|