C26H37OP — CID 172836977
(2,4-dipentylphenyl)phosphanyl-(2,4,6-trimethylphenyl)methanone (PubChem CID 172836977) has the molecular formula C26H37OP and a molecular weight of 396.56 g/mol. Its IUPAC name is (2,4-dipentylphenyl)phosphanyl-(2,4,6-trimethylphenyl)methanone.
| Compound Name | (2,4-dipentylphenyl)phosphanyl-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 172836977 |
| Molecular Formula | C26H37OP |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | (2,4-dipentylphenyl)phosphanyl-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCCCCc1ccc(PC(=O)c2c(C)cc(C)cc2C)c(CCCCC)c1 |
| InChI | InChI=1S/C26H37OP/c1-6-8-10-12-22-14-15-24(23(18-22)13-11-9-7-2)28-26(27)25-20(4)16-19(3)17-21(25)5/h14-18,28H,6-13H2,1-5H3 |
| InChIKey | WGXSABFACNJILC-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|