C9H10OS — CID 91881639
2,6-dimethylbenzenecarbothioic S-acid (PubChem CID 91881639) has the molecular formula C9H10OS and a molecular weight of 166.24 g/mol. Its IUPAC name is 2,6-dimethylbenzenecarbothioic S-acid.
| Compound Name | 2,6-dimethylbenzenecarbothioic S-acid |
|---|---|
| PubChem CID | 91881639 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 2,6-dimethylbenzenecarbothioic S-acid |
| SMILES | Cc1cccc(C)c1C(=O)S |
| InChI | InChI=1S/C9H10OS/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5H,1-2H3,(H,10,11) |
| InChIKey | RJLSQWUWBMUMPX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|