2,6-dimethylbenzenecarbothioic S-acid

C9H10OS — CID 91881639

IUPAC2,6-dimethylbenzenecarbothioic S-acid
SMILESCc1cccc(C)c1C(=O)S
InChIInChI=1S/C9H10OS/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5H,1-2H3,(H,10,11)
InChIKeyRJLSQWUWBMUMPX-UHFFFAOYSA-N
MW166.24 g/mol
LogP2.37
Rot. Bonds1

About 2,6-dimethylbenzenecarbothioic S-acid

2,6-dimethylbenzenecarbothioic S-acid (PubChem CID 91881639) has the molecular formula C9H10OS and a molecular weight of 166.24 g/mol. Its IUPAC name is 2,6-dimethylbenzenecarbothioic S-acid.

Molecular Properties

Compound Name2,6-dimethylbenzenecarbothioic S-acid
PubChem CID91881639
Molecular FormulaC9H10OS
Molecular Weight166.24 g/mol
Exact Mass166.05
IUPAC Name2,6-dimethylbenzenecarbothioic S-acid
SMILESCc1cccc(C)c1C(=O)S
InChIInChI=1S/C9H10OS/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5H,1-2H3,(H,10,11)
InChIKeyRJLSQWUWBMUMPX-UHFFFAOYSA-N
XLogP2.37
TPSA17.07 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.24
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2,6-dimethylbenzenecarbothioic S-acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dimethylbenzenecarbothioic S-acid?
The IUPAC name of 2,6-dimethylbenzenecarbothioic S-acid (CID 91881639) is 2,6-dimethylbenzenecarbothioic S-acid.
What is the SMILES notation for 2,6-dimethylbenzenecarbothioic S-acid?
The canonical SMILES for 2,6-dimethylbenzenecarbothioic S-acid is Cc1cccc(C)c1C(=O)S.
What is the InChIKey of 2,6-dimethylbenzenecarbothioic S-acid?
The InChIKey is RJLSQWUWBMUMPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10OS/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5H,1-2H3,(H,10,11).
What are the key properties of 2,6-dimethylbenzenecarbothioic S-acid?
2,6-dimethylbenzenecarbothioic S-acid has a molecular weight of 166.24 g/mol, XLogP of 2.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylbenzenecarbothioic S-acid is sourced from PubChem (CID 91881639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).