About 2,6-dimethylbenzoyl iodide
2,6-dimethylbenzoyl iodide (PubChem CID 87941795) has the molecular formula C9H9IO
and a molecular weight of 260.07 g/mol. Its IUPAC name is 2,6-dimethylbenzoyl iodide.
Molecular Properties
| Compound Name | 2,6-dimethylbenzoyl iodide |
| PubChem CID | 87941795 |
| Molecular Formula | C9H9IO |
| Molecular Weight | 260.07 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | 2,6-dimethylbenzoyl iodide |
| SMILES | Cc1cccc(C)c1C(=O)I |
| InChI | InChI=1S/C9H9IO/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5H,1-2H3 |
| InChIKey | VPYAOGLKDOOORS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.07 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylbenzoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylbenzoyl iodide?
The IUPAC name of 2,6-dimethylbenzoyl iodide (CID 87941795) is 2,6-dimethylbenzoyl iodide.
What is the SMILES notation for 2,6-dimethylbenzoyl iodide?
The canonical SMILES for 2,6-dimethylbenzoyl iodide is Cc1cccc(C)c1C(=O)I.
What is the InChIKey of 2,6-dimethylbenzoyl iodide?
The InChIKey is VPYAOGLKDOOORS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IO/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5H,1-2H3.
What are the key properties of 2,6-dimethylbenzoyl iodide?
2,6-dimethylbenzoyl iodide has a molecular weight of 260.07 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylbenzoyl iodide is sourced from PubChem (CID 87941795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).