C27H30F2O3 — CID 90049279
1-(4-ethoxyphenyl)-2,3-difluoro-4-[4-(6-methoxyhexoxy)phenyl]benzene (PubChem CID 90049279) has the molecular formula C27H30F2O3 and a molecular weight of 440.53 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2,3-difluoro-4-[4-(6-methoxyhexoxy)phenyl]benzene.
| Compound Name | 1-(4-ethoxyphenyl)-2,3-difluoro-4-[4-(6-methoxyhexoxy)phenyl]benzene |
|---|---|
| PubChem CID | 90049279 |
| Molecular Formula | C27H30F2O3 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2,3-difluoro-4-[4-(6-methoxyhexoxy)phenyl]benzene |
| SMILES | CCOc1ccc(-c2ccc(-c3ccc(OCCCCCCOC)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C27H30F2O3/c1-3-31-22-12-8-20(9-13-22)24-16-17-25(27(29)26(24)28)21-10-14-23(15-11-21)32-19-7-5-4-6-18-30-2/h8-17H,3-7,18-19H2,1-2H3 |
| InChIKey | IXGROYOEZFXWED-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|