C23H21F3O2 — CID 139861606
2-but-2-enoxy-3-(difluoromethoxy)-6-(4-ethylphenyl)-1-fluoronaphthalene (PubChem CID 139861606) has the molecular formula C23H21F3O2 and a molecular weight of 386.41 g/mol. Its IUPAC name is 2-but-2-enoxy-3-(difluoromethoxy)-6-(4-ethylphenyl)-1-fluoronaphthalene.
| Compound Name | 2-but-2-enoxy-3-(difluoromethoxy)-6-(4-ethylphenyl)-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139861606 |
| Molecular Formula | C23H21F3O2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-but-2-enoxy-3-(difluoromethoxy)-6-(4-ethylphenyl)-1-fluoronaphthalene |
| SMILES | CC=CCOc1c(OC(F)F)cc2cc(-c3ccc(CC)cc3)ccc2c1F |
| InChI | InChI=1S/C23H21F3O2/c1-3-5-12-27-22-20(28-23(25)26)14-18-13-17(10-11-19(18)21(22)24)16-8-6-15(4-2)7-9-16/h3,5-11,13-14,23H,4,12H2,1-2H3 |
| InChIKey | WNNIGSLWXUAVPO-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|