C22H19F3O — CID 139860896
3-(difluoromethoxy)-2-(4-ethylphenyl)-1-fluoro-6-[(E)-prop-1-enyl]naphthalene (PubChem CID 139860896) has the molecular formula C22H19F3O and a molecular weight of 356.39 g/mol. Its IUPAC name is 3-(difluoromethoxy)-2-(4-ethylphenyl)-1-fluoro-6-[(E)-prop-1-enyl]naphthalene.
| Compound Name | 3-(difluoromethoxy)-2-(4-ethylphenyl)-1-fluoro-6-[(E)-prop-1-enyl]naphthalene |
|---|---|
| PubChem CID | 139860896 |
| Molecular Formula | C22H19F3O |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 3-(difluoromethoxy)-2-(4-ethylphenyl)-1-fluoro-6-[(E)-prop-1-enyl]naphthalene |
| SMILES | C/C=C/c1ccc2c(F)c(-c3ccc(CC)cc3)c(OC(F)F)cc2c1 |
| InChI | InChI=1S/C22H19F3O/c1-3-5-15-8-11-18-17(12-15)13-19(26-22(24)25)20(21(18)23)16-9-6-14(4-2)7-10-16/h3,5-13,22H,4H2,1-2H3/b5-3+ |
| InChIKey | FTMNACSZLVYCIW-HWKANZROSA-N |
| XLogP | 6.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |