C24H21F3O2 — CID 139861394
6-(4-but-3-enylphenyl)-3-(difluoromethoxy)-1-fluoro-2-prop-2-enoxynaphthalene (PubChem CID 139861394) has the molecular formula C24H21F3O2 and a molecular weight of 398.42 g/mol. Its IUPAC name is 6-(4-but-3-enylphenyl)-3-(difluoromethoxy)-1-fluoro-2-prop-2-enoxynaphthalene.
| Compound Name | 6-(4-but-3-enylphenyl)-3-(difluoromethoxy)-1-fluoro-2-prop-2-enoxynaphthalene |
|---|---|
| PubChem CID | 139861394 |
| Molecular Formula | C24H21F3O2 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 6-(4-but-3-enylphenyl)-3-(difluoromethoxy)-1-fluoro-2-prop-2-enoxynaphthalene |
| SMILES | C=CCCc1ccc(-c2ccc3c(F)c(OCC=C)c(OC(F)F)cc3c2)cc1 |
| InChI | InChI=1S/C24H21F3O2/c1-3-5-6-16-7-9-17(10-8-16)18-11-12-20-19(14-18)15-21(29-24(26)27)23(22(20)25)28-13-4-2/h3-4,7-12,14-15,24H,1-2,5-6,13H2 |
| InChIKey | IULOFEGBFJZUCW-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|