C28H23F4NO — CID 139874232
5-but-3-enyl-2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]pyridine (PubChem CID 139874232) has the molecular formula C28H23F4NO and a molecular weight of 465.49 g/mol. Its IUPAC name is 5-but-3-enyl-2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]pyridine.
| Compound Name | 5-but-3-enyl-2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]pyridine |
|---|---|
| PubChem CID | 139874232 |
| Molecular Formula | C28H23F4NO |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 5-but-3-enyl-2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]pyridine |
| SMILES | C=CCCc1ccc(-c2ccc3c(F)c(CCc4ccc(OC(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C28H23F4NO/c1-2-3-4-19-6-13-25(33-17-19)22-11-12-23-21(16-22)10-9-20(27(23)30)8-5-18-7-14-26(24(29)15-18)34-28(31)32/h2,6-7,9-17,28H,1,3-5,8H2 |
| InChIKey | VESBPXWYBXSUJD-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|