C29H26F4N2O — CID 139873519
5-but-3-enyl-2-[2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]pyrimidine (PubChem CID 139873519) has the molecular formula C29H26F4N2O and a molecular weight of 494.53 g/mol. Its IUPAC name is 5-but-3-enyl-2-[2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]pyrimidine.
| Compound Name | 5-but-3-enyl-2-[2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]pyrimidine |
|---|---|
| PubChem CID | 139873519 |
| Molecular Formula | C29H26F4N2O |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 5-but-3-enyl-2-[2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]pyrimidine |
| SMILES | C=CCCc1cnc(CCc2ccc3c(F)c(CCc4ccc(OC(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C29H26F4N2O/c1-2-3-4-21-17-34-27(35-18-21)14-8-19-6-12-24-23(15-19)11-10-22(28(24)31)9-5-20-7-13-26(25(30)16-20)36-29(32)33/h2,6-7,10-13,15-18,29H,1,3-5,8-9,14H2 |
| InChIKey | HUOSBBUOKFGAAB-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|