C28H24F4N2 — CID 139874315
5-but-3-enyl-2-[2-[5-fluoro-6-[2-(3,4,5-trifluorophenyl)ethyl]naphthalen-2-yl]ethyl]pyrimidine (PubChem CID 139874315) has the molecular formula C28H24F4N2 and a molecular weight of 464.51 g/mol. Its IUPAC name is 5-but-3-enyl-2-[2-[5-fluoro-6-[2-(3,4,5-trifluorophenyl)ethyl]naphthalen-2-yl]ethyl]pyrimidine.
| Compound Name | 5-but-3-enyl-2-[2-[5-fluoro-6-[2-(3,4,5-trifluorophenyl)ethyl]naphthalen-2-yl]ethyl]pyrimidine |
|---|---|
| PubChem CID | 139874315 |
| Molecular Formula | C28H24F4N2 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 5-but-3-enyl-2-[2-[5-fluoro-6-[2-(3,4,5-trifluorophenyl)ethyl]naphthalen-2-yl]ethyl]pyrimidine |
| SMILES | C=CCCc1cnc(CCc2ccc3c(F)c(CCc4cc(F)c(F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C28H24F4N2/c1-2-3-4-20-16-33-26(34-17-20)12-7-18-6-11-23-22(13-18)10-9-21(27(23)31)8-5-19-14-24(29)28(32)25(30)15-19/h2,6,9-11,13-17H,1,3-5,7-8,12H2 |
| InChIKey | UCCWJQOREVEBSR-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|