C27H23ClF2N2O — CID 139873941
2-[2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-prop-2-enoxypyrimidine (PubChem CID 139873941) has the molecular formula C27H23ClF2N2O and a molecular weight of 464.94 g/mol. Its IUPAC name is 2-[2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-prop-2-enoxypyrimidine.
| Compound Name | 2-[2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-prop-2-enoxypyrimidine |
|---|---|
| PubChem CID | 139873941 |
| Molecular Formula | C27H23ClF2N2O |
| Molecular Weight | 464.94 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 2-[2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-prop-2-enoxypyrimidine |
| SMILES | C=CCOc1cnc(CCc2ccc3c(F)c(CCc4ccc(Cl)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C27H23ClF2N2O/c1-2-13-33-22-16-31-26(32-17-22)12-6-18-4-10-23-21(14-18)9-8-20(27(23)30)7-3-19-5-11-24(28)25(29)15-19/h2,4-5,8-11,14-17H,1,3,6-7,12-13H2 |
| InChIKey | XXGQTRRQMJLJEG-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.94 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|