C29H24ClF3O — CID 139874139
2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-1-fluoro-6-[2-(4-prop-2-enoxyphenyl)ethyl]naphthalene (PubChem CID 139874139) has the molecular formula C29H24ClF3O and a molecular weight of 480.96 g/mol. Its IUPAC name is 2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-1-fluoro-6-[2-(4-prop-2-enoxyphenyl)ethyl]naphthalene.
| Compound Name | 2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-1-fluoro-6-[2-(4-prop-2-enoxyphenyl)ethyl]naphthalene |
|---|---|
| PubChem CID | 139874139 |
| Molecular Formula | C29H24ClF3O |
| Molecular Weight | 480.96 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-1-fluoro-6-[2-(4-prop-2-enoxyphenyl)ethyl]naphthalene |
| SMILES | C=CCOc1ccc(CCc2ccc3c(F)c(CCc4cc(F)c(Cl)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C29H24ClF3O/c1-2-15-34-24-12-6-19(7-13-24)3-4-20-8-14-25-23(16-20)11-10-22(29(25)33)9-5-21-17-26(31)28(30)27(32)18-21/h2,6-8,10-14,16-18H,1,3-5,9,15H2 |
| InChIKey | PSRSUEWLKLTERB-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.96 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|