C27H25ClF2N2O — CID 139870722
2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-pentoxypyrimidine (PubChem CID 139870722) has the molecular formula C27H25ClF2N2O and a molecular weight of 466.96 g/mol. Its IUPAC name is 2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-pentoxypyrimidine.
| Compound Name | 2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-pentoxypyrimidine |
|---|---|
| PubChem CID | 139870722 |
| Molecular Formula | C27H25ClF2N2O |
| Molecular Weight | 466.96 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-pentoxypyrimidine |
| SMILES | CCCCCOc1cnc(-c2ccc3c(F)c(CCc4ccc(Cl)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C27H25ClF2N2O/c1-2-3-4-13-33-22-16-31-27(32-17-22)21-10-11-23-20(15-21)9-8-19(26(23)30)7-5-18-6-12-24(28)25(29)14-18/h6,8-12,14-17H,2-5,7,13H2,1H3 |
| InChIKey | GJFYERCLNQDMHB-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.96 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|