C30H30FN3O — CID 139872469
4-[2-[1-fluoro-6-(5-heptoxypyrimidin-2-yl)naphthalen-2-yl]ethyl]benzonitrile (PubChem CID 139872469) has the molecular formula C30H30FN3O and a molecular weight of 467.59 g/mol. Its IUPAC name is 4-[2-[1-fluoro-6-(5-heptoxypyrimidin-2-yl)naphthalen-2-yl]ethyl]benzonitrile.
| Compound Name | 4-[2-[1-fluoro-6-(5-heptoxypyrimidin-2-yl)naphthalen-2-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 139872469 |
| Molecular Formula | C30H30FN3O |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 4-[2-[1-fluoro-6-(5-heptoxypyrimidin-2-yl)naphthalen-2-yl]ethyl]benzonitrile |
| SMILES | CCCCCCCOc1cnc(-c2ccc3c(F)c(CCc4ccc(C#N)cc4)ccc3c2)nc1 |
| InChI | InChI=1S/C30H30FN3O/c1-2-3-4-5-6-17-35-27-20-33-30(34-21-27)26-15-16-28-25(18-26)14-13-24(29(28)31)12-11-22-7-9-23(19-32)10-8-22/h7-10,13-16,18,20-21H,2-6,11-12,17H2,1H3 |
| InChIKey | IXMCBGIVPFYICD-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|