C31H29F2NO — CID 139870962
4-[2-[1-fluoro-6-(2-fluoro-4-hexoxyphenyl)naphthalen-2-yl]ethyl]benzonitrile (PubChem CID 139870962) has the molecular formula C31H29F2NO and a molecular weight of 469.58 g/mol. Its IUPAC name is 4-[2-[1-fluoro-6-(2-fluoro-4-hexoxyphenyl)naphthalen-2-yl]ethyl]benzonitrile.
| Compound Name | 4-[2-[1-fluoro-6-(2-fluoro-4-hexoxyphenyl)naphthalen-2-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 139870962 |
| Molecular Formula | C31H29F2NO |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 4-[2-[1-fluoro-6-(2-fluoro-4-hexoxyphenyl)naphthalen-2-yl]ethyl]benzonitrile |
| SMILES | CCCCCCOc1ccc(-c2ccc3c(F)c(CCc4ccc(C#N)cc4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C31H29F2NO/c1-2-3-4-5-18-35-27-15-17-28(30(32)20-27)25-14-16-29-26(19-25)13-12-24(31(29)33)11-10-22-6-8-23(21-34)9-7-22/h6-9,12-17,19-20H,2-5,10-11,18H2,1H3 |
| InChIKey | CDDKDXNMVAVXKW-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|