C28H21F2NO — CID 139874546
4-[2-[1-fluoro-6-(2-fluoro-4-prop-2-enoxyphenyl)naphthalen-2-yl]ethyl]benzonitrile (PubChem CID 139874546) has the molecular formula C28H21F2NO and a molecular weight of 425.48 g/mol. Its IUPAC name is 4-[2-[1-fluoro-6-(2-fluoro-4-prop-2-enoxyphenyl)naphthalen-2-yl]ethyl]benzonitrile.
| Compound Name | 4-[2-[1-fluoro-6-(2-fluoro-4-prop-2-enoxyphenyl)naphthalen-2-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 139874546 |
| Molecular Formula | C28H21F2NO |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 4-[2-[1-fluoro-6-(2-fluoro-4-prop-2-enoxyphenyl)naphthalen-2-yl]ethyl]benzonitrile |
| SMILES | C=CCOc1ccc(-c2ccc3c(F)c(CCc4ccc(C#N)cc4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C28H21F2NO/c1-2-15-32-24-12-14-25(27(29)17-24)22-11-13-26-23(16-22)10-9-21(28(26)30)8-7-19-3-5-20(18-31)6-4-19/h2-6,9-14,16-17H,1,7-8,15H2 |
| InChIKey | CEAYWPTUAZJTGX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|