C27H19F5O — CID 139874633
1-fluoro-6-(2-fluoro-4-prop-2-enoxyphenyl)-2-[2-(3,4,5-trifluorophenyl)ethyl]naphthalene (PubChem CID 139874633) has the molecular formula C27H19F5O and a molecular weight of 454.44 g/mol. Its IUPAC name is 1-fluoro-6-(2-fluoro-4-prop-2-enoxyphenyl)-2-[2-(3,4,5-trifluorophenyl)ethyl]naphthalene.
| Compound Name | 1-fluoro-6-(2-fluoro-4-prop-2-enoxyphenyl)-2-[2-(3,4,5-trifluorophenyl)ethyl]naphthalene |
|---|---|
| PubChem CID | 139874633 |
| Molecular Formula | C27H19F5O |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 1-fluoro-6-(2-fluoro-4-prop-2-enoxyphenyl)-2-[2-(3,4,5-trifluorophenyl)ethyl]naphthalene |
| SMILES | C=CCOc1ccc(-c2ccc3c(F)c(CCc4cc(F)c(F)c(F)c4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C27H19F5O/c1-2-11-33-20-8-10-21(23(28)15-20)18-7-9-22-19(14-18)6-5-17(26(22)31)4-3-16-12-24(29)27(32)25(30)13-16/h2,5-10,12-15H,1,3-4,11H2 |
| InChIKey | WHZJZIKZQJGGEC-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|