C29H23F2N — CID 139873321
4-[2-[6-(4-but-3-enyl-2-fluorophenyl)-1-fluoronaphthalen-2-yl]ethyl]benzonitrile (PubChem CID 139873321) has the molecular formula C29H23F2N and a molecular weight of 423.51 g/mol. Its IUPAC name is 4-[2-[6-(4-but-3-enyl-2-fluorophenyl)-1-fluoronaphthalen-2-yl]ethyl]benzonitrile.
| Compound Name | 4-[2-[6-(4-but-3-enyl-2-fluorophenyl)-1-fluoronaphthalen-2-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 139873321 |
| Molecular Formula | C29H23F2N |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 4-[2-[6-(4-but-3-enyl-2-fluorophenyl)-1-fluoronaphthalen-2-yl]ethyl]benzonitrile |
| SMILES | C=CCCc1ccc(-c2ccc3c(F)c(CCc4ccc(C#N)cc4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C29H23F2N/c1-2-3-4-21-10-15-26(28(30)17-21)24-14-16-27-25(18-24)13-12-23(29(27)31)11-9-20-5-7-22(19-32)8-6-20/h2,5-8,10,12-18H,1,3-4,9,11H2 |
| InChIKey | FTUGVQAYHZXWJA-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|