C27H23F5N2O2 — CID 139872639
5-butoxy-2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]pyrimidine (PubChem CID 139872639) has the molecular formula C27H23F5N2O2 and a molecular weight of 502.48 g/mol. Its IUPAC name is 5-butoxy-2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]pyrimidine.
| Compound Name | 5-butoxy-2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]pyrimidine |
|---|---|
| PubChem CID | 139872639 |
| Molecular Formula | C27H23F5N2O2 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 5-butoxy-2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]pyrimidine |
| SMILES | CCCCOc1cnc(-c2ccc3c(F)c(CCc4ccc(OC(F)(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C27H23F5N2O2/c1-2-3-12-35-21-15-33-26(34-16-21)20-9-10-22-19(14-20)8-7-18(25(22)29)6-4-17-5-11-24(23(28)13-17)36-27(30,31)32/h5,7-11,13-16H,2-4,6,12H2,1H3 |
| InChIKey | PWCJMHSUUYXJRC-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|