C30H28F6N2O2 — CID 139870907
2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-pentoxypyrimidine (PubChem CID 139870907) has the molecular formula C30H28F6N2O2 and a molecular weight of 562.55 g/mol. Its IUPAC name is 2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-pentoxypyrimidine.
| Compound Name | 2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-pentoxypyrimidine |
|---|---|
| PubChem CID | 139870907 |
| Molecular Formula | C30H28F6N2O2 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-pentoxypyrimidine |
| SMILES | CCCCCOc1cnc(CCc2ccc3c(F)c(CCc4cc(F)c(OC(F)(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C30H28F6N2O2/c1-2-3-4-13-39-23-17-37-27(38-18-23)12-7-19-6-11-24-22(14-19)10-9-21(28(24)33)8-5-20-15-25(31)29(26(32)16-20)40-30(34,35)36/h6,9-11,14-18H,2-5,7-8,12-13H2,1H3 |
| InChIKey | ZSXWOSFKNOEJEX-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|