C31H30F6N2O2 — CID 139874910
2-[2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-pentoxypyrimidine (PubChem CID 139874910) has the molecular formula C31H30F6N2O2 and a molecular weight of 576.58 g/mol. Its IUPAC name is 2-[2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-pentoxypyrimidine.
| Compound Name | 2-[2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-pentoxypyrimidine |
|---|---|
| PubChem CID | 139874910 |
| Molecular Formula | C31H30F6N2O2 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | 2-[2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-pentoxypyrimidine |
| SMILES | CCCCCOc1cnc(CCc2ccc3c(F)c(CCc4cc(F)c(OCC(F)(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C31H30F6N2O2/c1-2-3-4-13-40-24-17-38-28(39-18-24)12-7-20-6-11-25-23(14-20)10-9-22(29(25)34)8-5-21-15-26(32)30(27(33)16-21)41-19-31(35,36)37/h6,9-11,14-18H,2-5,7-8,12-13,19H2,1H3 |
| InChIKey | YLDRBIHLJKRQRZ-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|